C18H23N5O4 — CID 122353603
1-(2,3-dimethoxyphenyl)-3-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]urea (PubChem CID 122353603) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 122353603 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]urea |
| SMILES | COc1cccc(NC(=O)NCc2ccnc(N3CCOCC3)n2)c1OC |
| InChI | InChI=1S/C18H23N5O4/c1-25-15-5-3-4-14(16(15)26-2)22-18(24)20-12-13-6-7-19-17(21-13)23-8-10-27-11-9-23/h3-7H,8-12H2,1-2H3,(H2,20,22,24) |
| InChIKey | JYEPXIXKAYNCMD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |