C20H24N6O3 — CID 122355146
N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]-6-oxopiperidine-3-carboxamide (PubChem CID 122355146) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 122355146 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-[4-[(5-morpholin-4-ylpyridazin-3-yl)amino]phenyl]-6-oxopiperidine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccc(Nc3cc(N4CCOCC4)cnn3)cc2)CN1 |
| InChI | InChI=1S/C20H24N6O3/c27-19-6-1-14(12-21-19)20(28)24-16-4-2-15(3-5-16)23-18-11-17(13-22-25-18)26-7-9-29-10-8-26/h2-5,11,13-14H,1,6-10,12H2,(H,21,27)(H,23,25)(H,24,28) |
| InChIKey | LDLKJAJQCBTFPA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |