C25H29F5N2O5S — CID 122362915
N-[4-[4-(difluoromethoxy)phenyl]-2-non-1-ynyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]-2-methylsulfonylacetamide (PubChem CID 122362915) has the molecular formula C25H29F5N2O5S and a molecular weight of 564.57 g/mol. Its IUPAC name is N-[4-[4-(difluoromethoxy)phenyl]-2-non-1-ynyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[4-[4-(difluoromethoxy)phenyl]-2-non-1-ynyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 122362915 |
| Molecular Formula | C25H29F5N2O5S |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | N-[4-[4-(difluoromethoxy)phenyl]-2-non-1-ynyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridin-5-yl]-2-methylsulfonylacetamide |
| SMILES | CCCCCCCC#CC1(C(F)(F)F)CC(c2ccc(OC(F)F)cc2)=C(NC(=O)CS(C)(=O)=O)C(=O)N1 |
| InChI | InChI=1S/C25H29F5N2O5S/c1-3-4-5-6-7-8-9-14-24(25(28,29)30)15-19(17-10-12-18(13-11-17)37-23(26)27)21(22(34)32-24)31-20(33)16-38(2,35)36/h10-13,23H,3-8,15-16H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | ZVJZJGPVEGFBLY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|