C14H17N3O2 — CID 122366064
(5S)-4-benzyl-5-methyl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione (PubChem CID 122366064) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (5S)-4-benzyl-5-methyl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione.
| Compound Name | (5S)-4-benzyl-5-methyl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione |
|---|---|
| PubChem CID | 122366064 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (5S)-4-benzyl-5-methyl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione |
| SMILES | C=CCN1NC(=O)[C@H](C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C14H17N3O2/c1-3-9-17-14(19)16(11(2)13(18)15-17)10-12-7-5-4-6-8-12/h3-8,11H,1,9-10H2,2H3,(H,15,18)/t11-/m0/s1 |
| InChIKey | HHWGCTZAHBOPDX-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|