C13H15N5O — CID 122369866
1-(furan-2-yl)-N,N-bis(pyrazol-1-ylmethyl)methanamine (PubChem CID 122369866) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-(furan-2-yl)-N,N-bis(pyrazol-1-ylmethyl)methanamine.
| Compound Name | 1-(furan-2-yl)-N,N-bis(pyrazol-1-ylmethyl)methanamine |
|---|---|
| PubChem CID | 122369866 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-(furan-2-yl)-N,N-bis(pyrazol-1-ylmethyl)methanamine |
| SMILES | c1coc(CN(Cn2cccn2)Cn2cccn2)c1 |
| InChI | InChI=1S/C13H15N5O/c1-4-13(19-9-1)10-16(11-17-7-2-5-14-17)12-18-8-3-6-15-18/h1-9H,10-12H2 |
| InChIKey | IRWIMVBWOVGUEB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |