C20H17N5 — CID 122370156
2,5-bis(1H-pyrrol-2-yl)-3,4-bis(1H-pyrrol-3-yl)-1H-pyrrole (PubChem CID 122370156) has the molecular formula C20H17N5 and a molecular weight of 327.39 g/mol. Its IUPAC name is 2,5-bis(1H-pyrrol-2-yl)-3,4-bis(1H-pyrrol-3-yl)-1H-pyrrole.
| Compound Name | 2,5-bis(1H-pyrrol-2-yl)-3,4-bis(1H-pyrrol-3-yl)-1H-pyrrole |
|---|---|
| PubChem CID | 122370156 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2,5-bis(1H-pyrrol-2-yl)-3,4-bis(1H-pyrrol-3-yl)-1H-pyrrole |
| SMILES | c1c[nH]c(-c2[nH]c(-c3ccc[nH]3)c(-c3cc[nH]c3)c2-c2cc[nH]c2)c1 |
| InChI | InChI=1S/C20H17N5/c1-3-15(23-7-1)19-17(13-5-9-21-11-13)18(14-6-10-22-12-14)20(25-19)16-4-2-8-24-16/h1-12,21-25H |
| InChIKey | HATKLZHOTBUULY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 0 |