C25H19NO4 — CID 122372067
ethyl 3-methyl-2-naphthalen-1-yl-4-oxochromeno[3,4-b]pyrrole-1-carboxylate (PubChem CID 122372067) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is ethyl 3-methyl-2-naphthalen-1-yl-4-oxochromeno[3,4-b]pyrrole-1-carboxylate.
| Compound Name | ethyl 3-methyl-2-naphthalen-1-yl-4-oxochromeno[3,4-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 122372067 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl 3-methyl-2-naphthalen-1-yl-4-oxochromeno[3,4-b]pyrrole-1-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccc3ccccc23)n(C)c2c(=O)oc3ccccc3c12 |
| InChI | InChI=1S/C25H19NO4/c1-3-29-24(27)21-20-18-12-6-7-14-19(18)30-25(28)23(20)26(2)22(21)17-13-8-10-15-9-4-5-11-16(15)17/h4-14H,3H2,1-2H3 |
| InChIKey | ACCJEGYKDMQYFP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|