C15H15N5O4 — CID 122373100
benzyl 2-[4-(2,4-dioxo-1,3-diazinan-5-yl)triazol-1-yl]acetate (PubChem CID 122373100) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is benzyl 2-[4-(2,4-dioxo-1,3-diazinan-5-yl)triazol-1-yl]acetate.
| Compound Name | benzyl 2-[4-(2,4-dioxo-1,3-diazinan-5-yl)triazol-1-yl]acetate |
|---|---|
| PubChem CID | 122373100 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | benzyl 2-[4-(2,4-dioxo-1,3-diazinan-5-yl)triazol-1-yl]acetate |
| SMILES | O=C1NCC(c2cn(CC(=O)OCc3ccccc3)nn2)C(=O)N1 |
| InChI | InChI=1S/C15H15N5O4/c21-13(24-9-10-4-2-1-3-5-10)8-20-7-12(18-19-20)11-6-16-15(23)17-14(11)22/h1-5,7,11H,6,8-9H2,(H2,16,17,22,23) |
| InChIKey | RMHGWERHZMVFDL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |