C26H30N6O9 — CID 71725747
benzyl 2-[4-[[1-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]triazol-4-yl]methyl]triazol-1-yl]acetate (PubChem CID 71725747) has the molecular formula C26H30N6O9 and a molecular weight of 570.56 g/mol. Its IUPAC name is benzyl 2-[4-[[1-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]triazol-4-yl]methyl]triazol-1-yl]acetate.
| Compound Name | benzyl 2-[4-[[1-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]triazol-4-yl]methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 71725747 |
| Molecular Formula | C26H30N6O9 |
| Molecular Weight | 570.56 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | benzyl 2-[4-[[1-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]triazol-4-yl]methyl]triazol-1-yl]acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C)O[C@H](n2cc(Cc3cn(CC(=O)OCc4ccccc4)nn3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H30N6O9/c1-15-23(39-16(2)33)24(40-17(3)34)25(41-18(4)35)26(38-15)32-12-21(28-30-32)10-20-11-31(29-27-20)13-22(36)37-14-19-8-6-5-7-9-19/h5-9,11-12,15,23-26H,10,13-14H2,1-4H3/t15-,23+,24+,25-,26-/m0/s1 |
| InChIKey | PLOAMJRYSVDZTJ-HWOBSPNASA-N |
| XLogP | 0.92 |
| TPSA | 175.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.56 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|