C38H34N2O8S — CID 122374398
(4-methoxyphenyl)methyl 2-(4-methoxyphenyl)sulfanylcarbonyl-2-[1-methyl-2-oxo-3-(phenylmethoxycarbonylamino)indol-3-yl]pent-4-ynoate (PubChem CID 122374398) has the molecular formula C38H34N2O8S and a molecular weight of 678.76 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-(4-methoxyphenyl)sulfanylcarbonyl-2-[1-methyl-2-oxo-3-(phenylmethoxycarbonylamino)indol-3-yl]pent-4-ynoate.
| Compound Name | (4-methoxyphenyl)methyl 2-(4-methoxyphenyl)sulfanylcarbonyl-2-[1-methyl-2-oxo-3-(phenylmethoxycarbonylamino)indol-3-yl]pent-4-ynoate |
|---|---|
| PubChem CID | 122374398 |
| Molecular Formula | C38H34N2O8S |
| Molecular Weight | 678.76 g/mol |
| Exact Mass | 678.20 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-(4-methoxyphenyl)sulfanylcarbonyl-2-[1-methyl-2-oxo-3-(phenylmethoxycarbonylamino)indol-3-yl]pent-4-ynoate |
| SMILES | C#CCC(C(=O)OCc1ccc(OC)cc1)(C(=O)Sc1ccc(OC)cc1)C1(NC(=O)OCc2ccccc2)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C38H34N2O8S/c1-5-23-37(35(43)49-30-21-19-29(46-4)20-22-30,34(42)47-24-27-15-17-28(45-3)18-16-27)38(31-13-9-10-14-32(31)40(2)33(38)41)39-36(44)48-25-26-11-7-6-8-12-26/h1,6-22H,23-25H2,2-4H3,(H,39,44) |
| InChIKey | UEEKNSQYVKMJSB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.76 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|