C31H32N2O8S — CID 122393951
(4-methoxyphenyl)methyl 2-[3-(ethoxycarbonylamino)-1-methyl-2-oxoindol-3-yl]-3-(4-methoxyphenyl)sulfanyl-2-methyl-3-oxopropanoate (PubChem CID 122393951) has the molecular formula C31H32N2O8S and a molecular weight of 592.67 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[3-(ethoxycarbonylamino)-1-methyl-2-oxoindol-3-yl]-3-(4-methoxyphenyl)sulfanyl-2-methyl-3-oxopropanoate.
| Compound Name | (4-methoxyphenyl)methyl 2-[3-(ethoxycarbonylamino)-1-methyl-2-oxoindol-3-yl]-3-(4-methoxyphenyl)sulfanyl-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 122393951 |
| Molecular Formula | C31H32N2O8S |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[3-(ethoxycarbonylamino)-1-methyl-2-oxoindol-3-yl]-3-(4-methoxyphenyl)sulfanyl-2-methyl-3-oxopropanoate |
| SMILES | CCOC(=O)NC1(C(C)(C(=O)OCc2ccc(OC)cc2)C(=O)Sc2ccc(OC)cc2)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C31H32N2O8S/c1-6-40-29(37)32-31(24-9-7-8-10-25(24)33(3)26(31)34)30(2,28(36)42-23-17-15-22(39-5)16-18-23)27(35)41-19-20-11-13-21(38-4)14-12-20/h7-18H,6,19H2,1-5H3,(H,32,37) |
| InChIKey | TVBRMXMZWNNRLX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|