C30H27NO5 — CID 122376433
dimethyl 1-phenacyl-4-phenyl-1,3,4,9-tetrahydrocarbazole-2,2-dicarboxylate (PubChem CID 122376433) has the molecular formula C30H27NO5 and a molecular weight of 481.55 g/mol. Its IUPAC name is dimethyl 1-phenacyl-4-phenyl-1,3,4,9-tetrahydrocarbazole-2,2-dicarboxylate.
| Compound Name | dimethyl 1-phenacyl-4-phenyl-1,3,4,9-tetrahydrocarbazole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 122376433 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | dimethyl 1-phenacyl-4-phenyl-1,3,4,9-tetrahydrocarbazole-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2ccccc2)c2c([nH]c3ccccc23)C1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H27NO5/c1-35-28(33)30(29(34)36-2)18-22(19-11-5-3-6-12-19)26-21-15-9-10-16-24(21)31-27(26)23(30)17-25(32)20-13-7-4-8-14-20/h3-16,22-23,31H,17-18H2,1-2H3 |
| InChIKey | BKRQEOKNKHZBBM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|