C24H40O3Si — CID 122378917
tert-butyl 2-[(1S,2R,3R,6S,7R,10R)-1,7,8,9,10-pentamethyl-5-trimethylsilyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]acetate (PubChem CID 122378917) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is tert-butyl 2-[(1S,2R,3R,6S,7R,10R)-1,7,8,9,10-pentamethyl-5-trimethylsilyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]acetate.
| Compound Name | tert-butyl 2-[(1S,2R,3R,6S,7R,10R)-1,7,8,9,10-pentamethyl-5-trimethylsilyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]acetate |
|---|---|
| PubChem CID | 122378917 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | tert-butyl 2-[(1S,2R,3R,6S,7R,10R)-1,7,8,9,10-pentamethyl-5-trimethylsilyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]acetate |
| SMILES | CC1=C(C)[C@]2(C)[C@H](C)[C@]1(C)[C@@H]1[C@@H](CC(=O)OC(C)(C)C)C=C(O[Si](C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C24H40O3Si/c1-14-15(2)24(8)16(3)23(14,7)20-17(13-19(25)26-22(4,5)6)12-18(21(20)24)27-28(9,10)11/h12,16-17,20-21H,13H2,1-11H3/t16-,17-,20-,21+,23-,24-/m1/s1 |
| InChIKey | OHBHOOKVCHXXLD-LZAHKNIMSA-N |
| XLogP | 6.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|