C16H18N2O2 — CID 122378962
2-tert-butyl-3,6-dihydropyrazino[1,2-b]isoquinoline-1,4-dione (PubChem CID 122378962) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-tert-butyl-3,6-dihydropyrazino[1,2-b]isoquinoline-1,4-dione.
| Compound Name | 2-tert-butyl-3,6-dihydropyrazino[1,2-b]isoquinoline-1,4-dione |
|---|---|
| PubChem CID | 122378962 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-tert-butyl-3,6-dihydropyrazino[1,2-b]isoquinoline-1,4-dione |
| SMILES | CC(C)(C)N1CC(=O)N2Cc3ccccc3C=C2C1=O |
| InChI | InChI=1S/C16H18N2O2/c1-16(2,3)18-10-14(19)17-9-12-7-5-4-6-11(12)8-13(17)15(18)20/h4-8H,9-10H2,1-3H3 |
| InChIKey | AMZAKKWHOHPCOF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |