C5H9NOS2 — CID 122379572
3-ethyl-4-hydroxy-1,3-thiazolidine-2-thione (PubChem CID 122379572) has the molecular formula C5H9NOS2 and a molecular weight of 163.27 g/mol. Its IUPAC name is 3-ethyl-4-hydroxy-1,3-thiazolidine-2-thione.
| Compound Name | 3-ethyl-4-hydroxy-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 122379572 |
| Molecular Formula | C5H9NOS2 |
| Molecular Weight | 163.27 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 3-ethyl-4-hydroxy-1,3-thiazolidine-2-thione |
| SMILES | CCN1C(=S)SCC1O |
| InChI | InChI=1S/C5H9NOS2/c1-2-6-4(7)3-9-5(6)8/h4,7H,2-3H2,1H3 |
| InChIKey | KDJWADFMHVIZSV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|