C30H32O8 — CID 122380494
bis[[4-(2-methoxyethoxy)phenyl]methyl] 2-ethenylbenzene-1,4-dicarboxylate (PubChem CID 122380494) has the molecular formula C30H32O8 and a molecular weight of 520.58 g/mol. Its IUPAC name is bis[[4-(2-methoxyethoxy)phenyl]methyl] 2-ethenylbenzene-1,4-dicarboxylate.
| Compound Name | bis[[4-(2-methoxyethoxy)phenyl]methyl] 2-ethenylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 122380494 |
| Molecular Formula | C30H32O8 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | bis[[4-(2-methoxyethoxy)phenyl]methyl] 2-ethenylbenzene-1,4-dicarboxylate |
| SMILES | C=Cc1cc(C(=O)OCc2ccc(OCCOC)cc2)ccc1C(=O)OCc1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C30H32O8/c1-4-24-19-25(29(31)37-20-22-5-10-26(11-6-22)35-17-15-33-2)9-14-28(24)30(32)38-21-23-7-12-27(13-8-23)36-18-16-34-3/h4-14,19H,1,15-18,20-21H2,2-3H3 |
| InChIKey | WDYHCBRSDAOHEC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|