C17H14BrNO5S — CID 122387375
(3'S,4S)-3'-bromo-3-(4-methylphenyl)sulfonylspiro[1,3-oxazolidine-4,2'-3H-1-benzofuran]-2-one (PubChem CID 122387375) has the molecular formula C17H14BrNO5S and a molecular weight of 424.27 g/mol. Its IUPAC name is (3'S,4S)-3'-bromo-3-(4-methylphenyl)sulfonylspiro[1,3-oxazolidine-4,2'-3H-1-benzofuran]-2-one.
| Compound Name | (3'S,4S)-3'-bromo-3-(4-methylphenyl)sulfonylspiro[1,3-oxazolidine-4,2'-3H-1-benzofuran]-2-one |
|---|---|
| PubChem CID | 122387375 |
| Molecular Formula | C17H14BrNO5S |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | (3'S,4S)-3'-bromo-3-(4-methylphenyl)sulfonylspiro[1,3-oxazolidine-4,2'-3H-1-benzofuran]-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)OC[C@@]23Oc2ccccc2[C@@H]3Br)cc1 |
| InChI | InChI=1S/C17H14BrNO5S/c1-11-6-8-12(9-7-11)25(21,22)19-16(20)23-10-17(19)15(18)13-4-2-3-5-14(13)24-17/h2-9,15H,10H2,1H3/t15-,17-/m0/s1 |
| InChIKey | SOYHNBJJUOXFPP-RDJZCZTQSA-N |
| XLogP | 3.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|