C34H46O3P2 — CID 122389535
[2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-diethylphosphane (PubChem CID 122389535) has the molecular formula C34H46O3P2 and a molecular weight of 564.69 g/mol. Its IUPAC name is [2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-diethylphosphane.
| Compound Name | [2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-diethylphosphane |
|---|---|
| PubChem CID | 122389535 |
| Molecular Formula | C34H46O3P2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | [2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]-diethylphosphane |
| SMILES | CCP(CC)c1ccccc1Op1oc2c(C(C)(C)C)cc(C)c(C)c2c2c(C)c(C)cc(C(C)(C)C)c2o1 |
| InChI | InChI=1S/C34H46O3P2/c1-13-38(14-2)28-18-16-15-17-27(28)35-39-36-31-25(33(7,8)9)19-21(3)23(5)29(31)30-24(6)22(4)20-26(32(30)37-39)34(10,11)12/h15-20H,13-14H2,1-12H3 |
| InChIKey | GHUVFLRLFVCHLM-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|