C42H54O3P2 — CID 11204613
2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl-bis(3,5-dimethylphenyl)phosphane (PubChem CID 11204613) has the molecular formula C42H54O3P2 and a molecular weight of 668.84 g/mol. Its IUPAC name is 2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | 2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 11204613 |
| Molecular Formula | C42H54O3P2 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | 2-(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(CCOp2oc3c(C(C)(C)C)cc(C)c(C)c3c3c(C)c(C)cc(C(C)(C)C)c3o2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C42H54O3P2/c1-25-17-26(2)20-33(19-25)46(34-21-27(3)18-28(4)22-34)16-15-43-47-44-39-35(41(9,10)11)23-29(5)31(7)37(39)38-32(8)30(6)24-36(40(38)45-47)42(12,13)14/h17-24H,15-16H2,1-14H3 |
| InChIKey | HLTMFUISEWYNIQ-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|