C64H82N2O4P2 — CID 21019042
N,N'-bis(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)-N,N'-diphenylbutane-1,4-diamine (PubChem CID 21019042) has the molecular formula C64H82N2O4P2 and a molecular weight of 1005.32 g/mol. Its IUPAC name is N,N'-bis(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)-N,N'-diphenylbutane-1,4-diamine.
| Compound Name | N,N'-bis(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)-N,N'-diphenylbutane-1,4-diamine |
|---|---|
| PubChem CID | 21019042 |
| Molecular Formula | C64H82N2O4P2 |
| Molecular Weight | 1005.32 g/mol |
| Exact Mass | 1004.57 |
| IUPAC Name | N,N'-bis(4,8-ditert-butyl-1,2,10,11-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)-N,N'-diphenylbutane-1,4-diamine |
| SMILES | Cc1cc(C(C)(C)C)c2op(N(CCCCN(c3ccccc3)p3oc4c(C(C)(C)C)cc(C)c(C)c4c4c(C)c(C)cc(C(C)(C)C)c4o3)c3ccccc3)oc3c(C(C)(C)C)cc(C)c(C)c3c2c1C |
| InChI | InChI=1S/C64H82N2O4P2/c1-39-35-49(61(9,10)11)57-53(43(39)5)54-44(6)40(2)36-50(62(12,13)14)58(54)68-71(67-57)65(47-29-23-21-24-30-47)33-27-28-34-66(48-31-25-22-26-32-48)72-69-59-51(63(15,16)17)37-41(3)45(7)55(59)56-46(8)42(4)38-52(60(56)70-72)64(18,19)20/h21-26,29-32,35-38H,27-28,33-34H2,1-20H3 |
| InChIKey | HAAWREJRRDADOY-UHFFFAOYSA-N |
| XLogP | 20.57 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.32 |
| LogP ≤ 5 | 20.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|