C20H24O2 — CID 11460670
3-(6-tert-butyl-2,3,4-trimethylphenyl)-3-phenyldioxirane (PubChem CID 11460670) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(6-tert-butyl-2,3,4-trimethylphenyl)-3-phenyldioxirane.
| Compound Name | 3-(6-tert-butyl-2,3,4-trimethylphenyl)-3-phenyldioxirane |
|---|---|
| PubChem CID | 11460670 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-(6-tert-butyl-2,3,4-trimethylphenyl)-3-phenyldioxirane |
| SMILES | Cc1cc(C(C)(C)C)c(C2(c3ccccc3)OO2)c(C)c1C |
| InChI | InChI=1S/C20H24O2/c1-13-12-17(19(4,5)6)18(15(3)14(13)2)20(21-22-20)16-10-8-7-9-11-16/h7-12H,1-6H3 |
| InChIKey | HSUDQJMFZHJIFZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|