C17H28O6 — CID 122389876
tert-butyl (1R,5R,7S)-7-(methoxymethoxy)-2-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 122389876) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl (1R,5R,7S)-7-(methoxymethoxy)-2-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | tert-butyl (1R,5R,7S)-7-(methoxymethoxy)-2-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 122389876 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | tert-butyl (1R,5R,7S)-7-(methoxymethoxy)-2-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COCO[C@H]1C[C@@]2(C(C)C)CCC(=O)[C@]1(C(=O)OC(C)(C)C)O2 |
| InChI | InChI=1S/C17H28O6/c1-11(2)16-8-7-12(18)17(23-16,13(9-16)21-10-20-6)14(19)22-15(3,4)5/h11,13H,7-10H2,1-6H3/t13-,16+,17-/m0/s1 |
| InChIKey | SCTYJBLHWTZSSH-XKQJLSEDSA-N |
| XLogP | 2.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|