C19H28O7 — CID 139050153
ethyl (2S,3R,4R)-4-cyclohexyl-2,8,8-trimethyl-6,10-dioxo-1,7,9-trioxaspiro[4.5]decane-3-carboxylate (PubChem CID 139050153) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl (2S,3R,4R)-4-cyclohexyl-2,8,8-trimethyl-6,10-dioxo-1,7,9-trioxaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (2S,3R,4R)-4-cyclohexyl-2,8,8-trimethyl-6,10-dioxo-1,7,9-trioxaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 139050153 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl (2S,3R,4R)-4-cyclohexyl-2,8,8-trimethyl-6,10-dioxo-1,7,9-trioxaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](C)OC2(C(=O)OC(C)(C)OC2=O)[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C19H28O7/c1-5-23-15(20)13-11(2)24-19(14(13)12-9-7-6-8-10-12)16(21)25-18(3,4)26-17(19)22/h11-14H,5-10H2,1-4H3/t11-,13-,14+/m0/s1 |
| InChIKey | XZGVNSALYRGAPO-FPMFFAJLSA-N |
| XLogP | 2.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|