C32H48O14 — CID 139050149
ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate;ethyl (2S,3R,4R)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate (PubChem CID 139050149) has the molecular formula C32H48O14 and a molecular weight of 656.72 g/mol. Its IUPAC name is ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate;ethyl (2S,3R,4R)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate;ethyl (2S,3R,4R)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 139050149 |
| Molecular Formula | C32H48O14 |
| Molecular Weight | 656.72 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate;ethyl (2S,3R,4R)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C)OC2(C(=O)OC(C)(C)OC2=O)[C@H]1C(C)C.CCOC(=O)[C@H]1[C@H](C)OC2(C(=O)OC(C)(C)OC2=O)[C@@H]1C(C)C |
| InChI | InChI=1S/2C16H24O7/c2*1-7-20-12(17)10-9(4)21-16(11(10)8(2)3)13(18)22-15(5,6)23-14(16)19/h2*8-11H,7H2,1-6H3/t2*9-,10-,11+/m10/s1 |
| InChIKey | DXDXOMUGJADGDD-WYDXRQDBSA-N |
| XLogP | 2.86 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|