C15H22O6 — CID 139050152
(2R,3S,4S)-3-acetyl-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione (PubChem CID 139050152) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2R,3S,4S)-3-acetyl-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione.
| Compound Name | (2R,3S,4S)-3-acetyl-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione |
|---|---|
| PubChem CID | 139050152 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2R,3S,4S)-3-acetyl-2,8,8-trimethyl-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-6,10-dione |
| SMILES | CC(=O)[C@@H]1[C@@H](C)OC2(C(=O)OC(C)(C)OC2=O)[C@H]1C(C)C |
| InChI | InChI=1S/C15H22O6/c1-7(2)11-10(8(3)16)9(4)19-15(11)12(17)20-14(5,6)21-13(15)18/h7,9-11H,1-6H3/t9-,10-,11+/m1/s1 |
| InChIKey | LQLZKFPDRNPTHJ-MXWKQRLJSA-N |
| XLogP | 1.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|