C18H30O7 — CID 170616021
methyl (2S)-6-(3-acetyloxypropyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxane-2-carboxylate (PubChem CID 170616021) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is methyl (2S)-6-(3-acetyloxypropyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxane-2-carboxylate.
| Compound Name | methyl (2S)-6-(3-acetyloxypropyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 170616021 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | methyl (2S)-6-(3-acetyloxypropyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(CC2COC(C)(C)O2)CCCC(CCCOC(C)=O)O1 |
| InChI | InChI=1S/C18H30O7/c1-13(19)22-10-6-8-14-7-5-9-18(25-14,16(20)21-4)11-15-12-23-17(2,3)24-15/h14-15H,5-12H2,1-4H3/t14?,15?,18-/m0/s1 |
| InChIKey | CINSHNBQYVPGDE-JMLCCBQJSA-N |
| XLogP | 2.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|