C30H23NO2 — CID 122390208
(3S)-2-(4-methoxyphenyl)-3-[2-(4-methylphenyl)ethynyl]-6-phenyl-3H-isoindol-1-one (PubChem CID 122390208) has the molecular formula C30H23NO2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (3S)-2-(4-methoxyphenyl)-3-[2-(4-methylphenyl)ethynyl]-6-phenyl-3H-isoindol-1-one.
| Compound Name | (3S)-2-(4-methoxyphenyl)-3-[2-(4-methylphenyl)ethynyl]-6-phenyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 122390208 |
| Molecular Formula | C30H23NO2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (3S)-2-(4-methoxyphenyl)-3-[2-(4-methylphenyl)ethynyl]-6-phenyl-3H-isoindol-1-one |
| SMILES | COc1ccc(N2C(=O)c3cc(-c4ccccc4)ccc3[C@@H]2C#Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H23NO2/c1-21-8-10-22(11-9-21)12-19-29-27-18-13-24(23-6-4-3-5-7-23)20-28(27)30(32)31(29)25-14-16-26(33-2)17-15-25/h3-11,13-18,20,29H,1-2H3/t29-/m0/s1 |
| InChIKey | ZILUAVDLIFQPJU-LJAQVGFWSA-N |
| XLogP | 6.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|