C26H23NO5 — CID 122390211
(3S)-6,7-dimethoxy-2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-3H-isoindol-1-one (PubChem CID 122390211) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is (3S)-6,7-dimethoxy-2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-3H-isoindol-1-one.
| Compound Name | (3S)-6,7-dimethoxy-2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 122390211 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (3S)-6,7-dimethoxy-2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-3H-isoindol-1-one |
| SMILES | COc1ccc(C#C[C@H]2c3ccc(OC)c(OC)c3C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-29-19-10-5-17(6-11-19)7-15-22-21-14-16-23(31-3)25(32-4)24(21)26(28)27(22)18-8-12-20(30-2)13-9-18/h5-6,8-14,16,22H,1-4H3/t22-/m0/s1 |
| InChIKey | SRJQQGUGGGPXLE-QFIPXVFZSA-N |
| XLogP | 4.47 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|