C12H21BrF3NO2S — CID 122392030
N-[(Z)-1-bromooct-1-en-2-yl]-1,1,1-trifluoro-N-propylmethanesulfonamide (PubChem CID 122392030) has the molecular formula C12H21BrF3NO2S and a molecular weight of 380.27 g/mol. Its IUPAC name is N-[(Z)-1-bromooct-1-en-2-yl]-1,1,1-trifluoro-N-propylmethanesulfonamide.
| Compound Name | N-[(Z)-1-bromooct-1-en-2-yl]-1,1,1-trifluoro-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 122392030 |
| Molecular Formula | C12H21BrF3NO2S |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[(Z)-1-bromooct-1-en-2-yl]-1,1,1-trifluoro-N-propylmethanesulfonamide |
| SMILES | CCCCCC/C(=C/Br)N(CCC)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H21BrF3NO2S/c1-3-5-6-7-8-11(10-13)17(9-4-2)20(18,19)12(14,15)16/h10H,3-9H2,1-2H3/b11-10- |
| InChIKey | FOMAUBJMRMVVRW-KHPPLWFESA-N |
| XLogP | 4.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|