C30H23NO3 — CID 122392070
4',6'-dimethoxy-2',3'-diphenylspiro[2H-isoindole-3,1'-indene]-1-one (PubChem CID 122392070) has the molecular formula C30H23NO3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4',6'-dimethoxy-2',3'-diphenylspiro[2H-isoindole-3,1'-indene]-1-one.
| Compound Name | 4',6'-dimethoxy-2',3'-diphenylspiro[2H-isoindole-3,1'-indene]-1-one |
|---|---|
| PubChem CID | 122392070 |
| Molecular Formula | C30H23NO3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 4',6'-dimethoxy-2',3'-diphenylspiro[2H-isoindole-3,1'-indene]-1-one |
| SMILES | COc1cc(OC)c2c(c1)C1(NC(=O)c3ccccc31)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C30H23NO3/c1-33-21-17-24-27(25(18-21)34-2)26(19-11-5-3-6-12-19)28(20-13-7-4-8-14-20)30(24)23-16-10-9-15-22(23)29(32)31-30/h3-18H,1-2H3,(H,31,32) |
| InChIKey | FNOUUHVYNUTYSU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|