C53H43ClN4O7 — CID 122393805
dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-4'-chloro-9-ethenyl-4-methyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate (PubChem CID 122393805) has the molecular formula C53H43ClN4O7 and a molecular weight of 883.40 g/mol. Its IUPAC name is dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-4'-chloro-9-ethenyl-4-methyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate.
| Compound Name | dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-4'-chloro-9-ethenyl-4-methyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate |
|---|---|
| PubChem CID | 122393805 |
| Molecular Formula | C53H43ClN4O7 |
| Molecular Weight | 883.40 g/mol |
| Exact Mass | 882.28 |
| IUPAC Name | dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-4'-chloro-9-ethenyl-4-methyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC(c2ccccc2)c2ccccc2)(C(=O)OC(c2ccccc2)c2ccccc2)N2[C@@H]3C(=O)N(C)C(=O)[C@@H]3[C@@]3(C(=O)N(Cc4ccccc4)c4cccc(Cl)c43)N12 |
| InChI | InChI=1S/C53H43ClN4O7/c1-3-39-32-52(50(62)64-45(35-22-11-5-12-23-35)36-24-13-6-14-25-36,51(63)65-46(37-26-15-7-16-27-37)38-28-17-8-18-29-38)58-44-43(47(59)55(2)48(44)60)53(57(39)58)42-40(54)30-19-31-41(42)56(49(53)61)33-34-20-9-4-10-21-34/h3-31,39,43-46H,1,32-33H2,2H3/t39-,43-,44+,53+/m1/s1 |
| InChIKey | BWADCALWACZUPT-WRIPESTFSA-N |
| XLogP | 7.96 |
| TPSA | 116.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.40 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|