C54H46N4O7 — CID 122393808
dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-9-ethenyl-4,6'-dimethyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate (PubChem CID 122393808) has the molecular formula C54H46N4O7 and a molecular weight of 862.98 g/mol. Its IUPAC name is dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-9-ethenyl-4,6'-dimethyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate.
| Compound Name | dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-9-ethenyl-4,6'-dimethyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate |
|---|---|
| PubChem CID | 122393808 |
| Molecular Formula | C54H46N4O7 |
| Molecular Weight | 862.98 g/mol |
| Exact Mass | 862.34 |
| IUPAC Name | dibenzhydryl (2S,6S,7R,9S)-1'-benzyl-9-ethenyl-4,6'-dimethyl-2',3,5-trioxospiro[1,4,8-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-11,11-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC(c2ccccc2)c2ccccc2)(C(=O)OC(c2ccccc2)c2ccccc2)N2[C@@H]3C(=O)N(C)C(=O)[C@@H]3[C@@]3(C(=O)N(Cc4ccccc4)c4cc(C)ccc43)N12 |
| InChI | InChI=1S/C54H46N4O7/c1-4-41-33-53(51(62)64-46(37-22-12-6-13-23-37)38-24-14-7-15-25-38,52(63)65-47(39-26-16-8-17-27-39)40-28-18-9-19-29-40)58-45-44(48(59)55(3)49(45)60)54(57(41)58)42-31-30-35(2)32-43(42)56(50(54)61)34-36-20-10-5-11-21-36/h4-32,41,44-47H,1,33-34H2,2-3H3/t41-,44-,45+,54+/m1/s1 |
| InChIKey | MUWYLVFTDMEVKL-ZINXQBMLSA-N |
| XLogP | 7.62 |
| TPSA | 116.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.98 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|