C25H28N4O5S — CID 72792873
dipropan-2-yl 1'-benzyl-6'-methyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate (PubChem CID 72792873) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is dipropan-2-yl 1'-benzyl-6'-methyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl 1'-benzyl-6'-methyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate |
|---|---|
| PubChem CID | 72792873 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | dipropan-2-yl 1'-benzyl-6'-methyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate |
| SMILES | Cc1ccc2c(c1)N(Cc1ccccc1)C(=O)C21NC(=S)N(C(=O)OC(C)C)N1C(=O)OC(C)C |
| InChI | InChI=1S/C25H28N4O5S/c1-15(2)33-23(31)28-22(35)26-25(29(28)24(32)34-16(3)4)19-12-11-17(5)13-20(19)27(21(25)30)14-18-9-7-6-8-10-18/h6-13,15-16H,14H2,1-5H3,(H,26,35) |
| InChIKey | LICIMVPATBECNE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|