C24H26N4O5S — CID 72793276
dipropan-2-yl 1'-benzyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate (PubChem CID 72793276) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is dipropan-2-yl 1'-benzyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl 1'-benzyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate |
|---|---|
| PubChem CID | 72793276 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | dipropan-2-yl 1'-benzyl-2'-oxo-5-sulfanylidenespiro[1,2,4-triazolidine-3,3'-indole]-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)N1C(=S)NC2(C(=O)N(Cc3ccccc3)c3ccccc32)N1C(=O)OC(C)C |
| InChI | InChI=1S/C24H26N4O5S/c1-15(2)32-22(30)27-21(34)25-24(28(27)23(31)33-16(3)4)18-12-8-9-13-19(18)26(20(24)29)14-17-10-6-5-7-11-17/h5-13,15-16H,14H2,1-4H3,(H,25,34) |
| InChIKey | ITDCIKKMPKGFPM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|