C12H13FOS2 — CID 122399001
2-(1,3-dithian-2-yl)-1-(2-fluorophenyl)ethanone (PubChem CID 122399001) has the molecular formula C12H13FOS2 and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-(1,3-dithian-2-yl)-1-(2-fluorophenyl)ethanone.
| Compound Name | 2-(1,3-dithian-2-yl)-1-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 122399001 |
| Molecular Formula | C12H13FOS2 |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(1,3-dithian-2-yl)-1-(2-fluorophenyl)ethanone |
| SMILES | O=C(CC1SCCCS1)c1ccccc1F |
| InChI | InChI=1S/C12H13FOS2/c13-10-5-2-1-4-9(10)11(14)8-12-15-6-3-7-16-12/h1-2,4-5,12H,3,6-8H2 |
| InChIKey | JFAAGHJAPXLQPX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |