C24H30N8O5 — CID 122400382
10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxamide (PubChem CID 122400382) has the molecular formula C24H30N8O5 and a molecular weight of 510.56 g/mol. Its IUPAC name is 10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxamide.
| Compound Name | 10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxamide |
|---|---|
| PubChem CID | 122400382 |
| Molecular Formula | C24H30N8O5 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxamide |
| SMILES | NC(=O)N1CCN(Cc2ccc3c(=O)c4ccccc4oc3n2)CCN(C(N)=O)CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C24H30N8O5/c25-22(34)30-9-7-29(8-10-31(23(26)35)12-14-32(13-11-30)24(27)36)15-16-5-6-18-20(33)17-3-1-2-4-19(17)37-21(18)28-16/h1-6H,7-15H2,(H2,25,34)(H2,26,35)(H2,27,36) |
| InChIKey | JUNAOXIZFBSTSA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 185.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|