C20H20ClN5O — CID 91553260
4-[[2-(2-chlorophenyl)quinazolin-4-yl]methyl]piperazine-1-carboxamide (PubChem CID 91553260) has the molecular formula C20H20ClN5O and a molecular weight of 381.87 g/mol. Its IUPAC name is 4-[[2-(2-chlorophenyl)quinazolin-4-yl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-[[2-(2-chlorophenyl)quinazolin-4-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91553260 |
| Molecular Formula | C20H20ClN5O |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-[[2-(2-chlorophenyl)quinazolin-4-yl]methyl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(Cc2nc(-c3ccccc3Cl)nc3ccccc23)CC1 |
| InChI | InChI=1S/C20H20ClN5O/c21-16-7-3-1-5-14(16)19-23-17-8-4-2-6-15(17)18(24-19)13-25-9-11-26(12-10-25)20(22)27/h1-8H,9-13H2,(H2,22,27) |
| InChIKey | VRYIKBMXFWSCHC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |