C23H24Cl2N4O — CID 90727834
1-[4-[5-chloro-2-(2-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-3-methylbutan-2-one (PubChem CID 90727834) has the molecular formula C23H24Cl2N4O and a molecular weight of 443.38 g/mol. Its IUPAC name is 1-[4-[5-chloro-2-(2-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-3-methylbutan-2-one.
| Compound Name | 1-[4-[5-chloro-2-(2-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 90727834 |
| Molecular Formula | C23H24Cl2N4O |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-[4-[5-chloro-2-(2-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)CN1CCN(c2nc(-c3ccccc3Cl)nc3cccc(Cl)c23)CC1 |
| InChI | InChI=1S/C23H24Cl2N4O/c1-15(2)20(30)14-28-10-12-29(13-11-28)23-21-18(25)8-5-9-19(21)26-22(27-23)16-6-3-4-7-17(16)24/h3-9,15H,10-14H2,1-2H3 |
| InChIKey | SLCWFAPXZFRYMZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |