C46H64N6O7 — CID 89054157
ditert-butyl 7-[[6-(7-tert-butyl-5-oxochromeno[2,3-b]pyridin-2-yl)-2-pyridinyl]methyl]-10-(3,3-dimethylbutanoyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate (PubChem CID 89054157) has the molecular formula C46H64N6O7 and a molecular weight of 813.05 g/mol. Its IUPAC name is ditert-butyl 7-[[6-(7-tert-butyl-5-oxochromeno[2,3-b]pyridin-2-yl)-2-pyridinyl]methyl]-10-(3,3-dimethylbutanoyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate.
| Compound Name | ditert-butyl 7-[[6-(7-tert-butyl-5-oxochromeno[2,3-b]pyridin-2-yl)-2-pyridinyl]methyl]-10-(3,3-dimethylbutanoyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89054157 |
| Molecular Formula | C46H64N6O7 |
| Molecular Weight | 813.05 g/mol |
| Exact Mass | 812.48 |
| IUPAC Name | ditert-butyl 7-[[6-(7-tert-butyl-5-oxochromeno[2,3-b]pyridin-2-yl)-2-pyridinyl]methyl]-10-(3,3-dimethylbutanoyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate |
| SMILES | CC(C)(C)CC(=O)N1CCN(Cc2cccc(-c3ccc4c(=O)c5cc(C(C)(C)C)ccc5oc4n3)n2)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C46H64N6O7/c1-43(2,3)29-38(53)50-22-20-49(21-23-51(41(55)58-45(7,8)9)26-27-52(25-24-50)42(56)59-46(10,11)12)30-32-14-13-15-35(47-32)36-18-17-33-39(54)34-28-31(44(4,5)6)16-19-37(34)57-40(33)48-36/h13-19,28H,20-27,29-30H2,1-12H3 |
| InChIKey | CFWFCIKDPPNKDG-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 138.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.05 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|