C24H27N5O8 — CID 122400386
10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid (PubChem CID 122400386) has the molecular formula C24H27N5O8 and a molecular weight of 513.51 g/mol. Its IUPAC name is 10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid.
| Compound Name | 10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
|---|---|
| PubChem CID | 122400386 |
| Molecular Formula | C24H27N5O8 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 10-[(5-oxochromeno[2,3-b]pyridin-2-yl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2ccc3c(=O)c4ccccc4oc3n2)CCN(C(=O)O)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C24H27N5O8/c30-20-17-3-1-2-4-19(17)37-21-18(20)6-5-16(25-21)15-26-7-9-27(22(31)32)11-13-29(24(35)36)14-12-28(10-8-26)23(33)34/h1-6H,7-15H2,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | ICUFYCMOCKGTSI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|