C36H33N5O8 — CID 102414792
2-[carboxymethyl-[6-methyl-1,4-bis[(10-oxochromeno[3,2-c]pyridin-3-yl)methyl]-1,4-diazepan-6-yl]amino]acetic acid (PubChem CID 102414792) has the molecular formula C36H33N5O8 and a molecular weight of 663.69 g/mol. Its IUPAC name is 2-[carboxymethyl-[6-methyl-1,4-bis[(10-oxochromeno[3,2-c]pyridin-3-yl)methyl]-1,4-diazepan-6-yl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[6-methyl-1,4-bis[(10-oxochromeno[3,2-c]pyridin-3-yl)methyl]-1,4-diazepan-6-yl]amino]acetic acid |
|---|---|
| PubChem CID | 102414792 |
| Molecular Formula | C36H33N5O8 |
| Molecular Weight | 663.69 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | 2-[carboxymethyl-[6-methyl-1,4-bis[(10-oxochromeno[3,2-c]pyridin-3-yl)methyl]-1,4-diazepan-6-yl]amino]acetic acid |
| SMILES | CC1(N(CC(=O)O)CC(=O)O)CN(Cc2cc3oc4ccccc4c(=O)c3cn2)CCN(Cc2cc3oc4ccccc4c(=O)c3cn2)C1 |
| InChI | InChI=1S/C36H33N5O8/c1-36(41(18-32(42)43)19-33(44)45)20-39(16-22-12-30-26(14-37-22)34(46)24-6-2-4-8-28(24)48-30)10-11-40(21-36)17-23-13-31-27(15-38-23)35(47)25-7-3-5-9-29(25)49-31/h2-9,12-15H,10-11,16-21H2,1H3,(H,42,43)(H,44,45) |
| InChIKey | SVLHRLOLUJOBKZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|