About N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide
N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide (PubChem CID 122400482) has the molecular formula C25H24N2O2S
and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide |
| PubChem CID | 122400482 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide |
| SMILES | CC1=Nc2ccccc2[C@@]1(C)C/C=C/N(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-20-25(2,23-16-9-10-17-24(23)26-20)18-11-19-27(21-12-5-3-6-13-21)30(28,29)22-14-7-4-8-15-22/h3-17,19H,18H2,1-2H3/b19-11+/t25-/m0/s1 |
| InChIKey | PZYAOJUSJQZWPO-KDDABKDRSA-N |
| XLogP | 5.85 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide?
The IUPAC name of N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide (CID 122400482) is N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide.
What is the SMILES notation for N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide?
The canonical SMILES for N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide is CC1=Nc2ccccc2[C@@]1(C)C/C=C/N(c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide?
The InChIKey is PZYAOJUSJQZWPO-KDDABKDRSA-N. The full InChI is InChI=1S/C25H24N2O2S/c1-20-25(2,23-16-9-10-17-24(23)26-20)18-11-19-27(21-12-5-3-6-13-21)30(28,29)22-14-7-4-8-15-22/h3-17,19H,18H2,1-2H3/b19-11+/t25-/m0/s1.
What are the key properties of N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide?
N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide has a molecular weight of 416.55 g/mol, XLogP of 5.85, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3-[(3R)-2,3-dimethylindol-3-yl]prop-1-enyl]-N-phenylbenzenesulfonamide is sourced from PubChem (CID 122400482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).