C14H18O3 — CID 122401725
methyl 2-[(1R,1aS,3aR,7aR,7bS)-6-oxo-1,1a,3a,4,5,7,7a,7b-octahydrocyclopropa[a]naphthalen-1-yl]acetate (PubChem CID 122401725) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is methyl 2-[(1R,1aS,3aR,7aR,7bS)-6-oxo-1,1a,3a,4,5,7,7a,7b-octahydrocyclopropa[a]naphthalen-1-yl]acetate.
| Compound Name | methyl 2-[(1R,1aS,3aR,7aR,7bS)-6-oxo-1,1a,3a,4,5,7,7a,7b-octahydrocyclopropa[a]naphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 122401725 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | methyl 2-[(1R,1aS,3aR,7aR,7bS)-6-oxo-1,1a,3a,4,5,7,7a,7b-octahydrocyclopropa[a]naphthalen-1-yl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@@H]2C=C[C@H]3CCC(=O)C[C@H]3[C@@H]21 |
| InChI | InChI=1S/C14H18O3/c1-17-13(16)7-12-10-5-3-8-2-4-9(15)6-11(8)14(10)12/h3,5,8,10-12,14H,2,4,6-7H2,1H3/t8-,10+,11-,12-,14-/m1/s1 |
| InChIKey | PPPPJYSZEGJBBJ-YSUWEYJASA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|