C33H26NOP — CID 122402439
(3R)-3-(diphenylphosphorylmethyl)-1,3-diphenyl-2H-indolizin-4-ium-2-ide (PubChem CID 122402439) has the molecular formula C33H26NOP and a molecular weight of 483.55 g/mol. Its IUPAC name is (3R)-3-(diphenylphosphorylmethyl)-1,3-diphenyl-2H-indolizin-4-ium-2-ide.
| Compound Name | (3R)-3-(diphenylphosphorylmethyl)-1,3-diphenyl-2H-indolizin-4-ium-2-ide |
|---|---|
| PubChem CID | 122402439 |
| Molecular Formula | C33H26NOP |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (3R)-3-(diphenylphosphorylmethyl)-1,3-diphenyl-2H-indolizin-4-ium-2-ide |
| SMILES | O=P(C[C@]1(c2ccccc2)[C-]=C(c2ccccc2)c2cccc[n+]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H26NOP/c35-36(29-19-9-3-10-20-29,30-21-11-4-12-22-30)26-33(28-17-7-2-8-18-28)25-31(27-15-5-1-6-16-27)32-23-13-14-24-34(32)33/h1-24H,26H2/t33-/m0/s1 |
| InChIKey | OEMZJFOJDUPXOK-XIFFEERXSA-N |
| XLogP | 5.98 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|