C15H24O4 — CID 122403923
(E)-2,6-dihydroxy-2-(4-hydroxy-4-methylcyclohex-2-en-1-yl)-6-methylhept-4-en-3-one (PubChem CID 122403923) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (E)-2,6-dihydroxy-2-(4-hydroxy-4-methylcyclohex-2-en-1-yl)-6-methylhept-4-en-3-one.
| Compound Name | (E)-2,6-dihydroxy-2-(4-hydroxy-4-methylcyclohex-2-en-1-yl)-6-methylhept-4-en-3-one |
|---|---|
| PubChem CID | 122403923 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (E)-2,6-dihydroxy-2-(4-hydroxy-4-methylcyclohex-2-en-1-yl)-6-methylhept-4-en-3-one |
| SMILES | CC(C)(O)/C=C/C(=O)C(C)(O)C1C=CC(C)(O)CC1 |
| InChI | InChI=1S/C15H24O4/c1-13(2,17)8-7-12(16)15(4,19)11-5-9-14(3,18)10-6-11/h5,7-9,11,17-19H,6,10H2,1-4H3/b8-7+ |
| InChIKey | YAPMMUVQKDQVBB-BQYQJAHWSA-N |
| XLogP | 1.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|