C27H56O3Si2 — CID 122412358
[tert-butyl(dimethyl)silyl] (E,2R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate (PubChem CID 122412358) has the molecular formula C27H56O3Si2 and a molecular weight of 484.91 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (E,2R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (E,2R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate |
|---|---|
| PubChem CID | 122412358 |
| Molecular Formula | C27H56O3Si2 |
| Molecular Weight | 484.91 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (E,2R,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-2-(2-methylpropyl)hept-4-enoate |
| SMILES | CC(C)/C=C/C(CCCO[Si](C)(C)C(C)(C)C)[C@@H](CC(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O3Si2/c1-21(2)17-18-23(16-15-19-29-31(11,12)26(5,6)7)24(20-22(3)4)25(28)30-32(13,14)27(8,9)10/h17-18,21-24H,15-16,19-20H2,1-14H3/b18-17+/t23?,24-/m1/s1 |
| InChIKey | XUWOAQHKFHWYSO-YYNXROBGSA-N |
| XLogP | 8.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.91 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|