C23H46N2 — CID 122414767
1,2,2,5,5-pentamethyl-3-[5-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pentan-2-yl]pyrrolidine (PubChem CID 122414767) has the molecular formula C23H46N2 and a molecular weight of 350.64 g/mol. Its IUPAC name is 1,2,2,5,5-pentamethyl-3-[5-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pentan-2-yl]pyrrolidine.
| Compound Name | 1,2,2,5,5-pentamethyl-3-[5-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pentan-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 122414767 |
| Molecular Formula | C23H46N2 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.37 |
| IUPAC Name | 1,2,2,5,5-pentamethyl-3-[5-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pentan-2-yl]pyrrolidine |
| SMILES | CC(CCCC1CC(C)(C)N(C)C1(C)C)C1CC(C)(C)N(C)C1(C)C |
| InChI | InChI=1S/C23H46N2/c1-17(19-16-21(4,5)25(11)23(19,8)9)13-12-14-18-15-20(2,3)24(10)22(18,6)7/h17-19H,12-16H2,1-11H3 |
| InChIKey | XVVVZONAQSILRW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |