C31H27N5O2 — CID 122421936
4-[5-[3-[[(E)-4-(methylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-phenylbenzamide (PubChem CID 122421936) has the molecular formula C31H27N5O2 and a molecular weight of 501.59 g/mol. Its IUPAC name is 4-[5-[3-[[(E)-4-(methylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-phenylbenzamide.
| Compound Name | 4-[5-[3-[[(E)-4-(methylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 122421936 |
| Molecular Formula | C31H27N5O2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 4-[5-[3-[[(E)-4-(methylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N-phenylbenzamide |
| SMILES | CNC/C=C/C(=O)Nc1cccc(-c2cnc3[nH]cc(-c4ccc(C(=O)Nc5ccccc5)cc4)c3c2)c1 |
| InChI | InChI=1S/C31H27N5O2/c1-32-16-6-11-29(37)35-26-10-5-7-23(17-26)24-18-27-28(20-34-30(27)33-19-24)21-12-14-22(15-13-21)31(38)36-25-8-3-2-4-9-25/h2-15,17-20,32H,16H2,1H3,(H,33,34)(H,35,37)(H,36,38)/b11-6+ |
| InChIKey | ANWQKNVFKLNZDG-IZZDOVSWSA-N |
| XLogP | 5.86 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|