C12H21N3O3 — CID 122432483
tert-butyl 5-nitroso-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate (PubChem CID 122432483) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl 5-nitroso-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate.
| Compound Name | tert-butyl 5-nitroso-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 122432483 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | tert-butyl 5-nitroso-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCN(N=O)CC2C1 |
| InChI | InChI=1S/C12H21N3O3/c1-12(2,3)18-11(16)14-6-9-4-5-15(13-17)8-10(9)7-14/h9-10H,4-8H2,1-3H3 |
| InChIKey | CDUROCPIYLDHPI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|