C28H21N3O3 — CID 122435728
4-(dimethylamino)-2-(4-phenoxazin-10-ylphenyl)isoindole-1,3-dione (PubChem CID 122435728) has the molecular formula C28H21N3O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-(dimethylamino)-2-(4-phenoxazin-10-ylphenyl)isoindole-1,3-dione.
| Compound Name | 4-(dimethylamino)-2-(4-phenoxazin-10-ylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 122435728 |
| Molecular Formula | C28H21N3O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-(dimethylamino)-2-(4-phenoxazin-10-ylphenyl)isoindole-1,3-dione |
| SMILES | CN(C)c1cccc2c1C(=O)N(c1ccc(N3c4ccccc4Oc4ccccc43)cc1)C2=O |
| InChI | InChI=1S/C28H21N3O3/c1-29(2)23-11-7-8-20-26(23)28(33)31(27(20)32)19-16-14-18(15-17-19)30-21-9-3-5-12-24(21)34-25-13-6-4-10-22(25)30/h3-17H,1-2H3 |
| InChIKey | CQMWBWOUCMHDHL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|